About 1-(dimethylaminooxy)ethylazanide;tantalum;terbium
1-(dimethylaminooxy)ethylazanide;tantalum;terbium (PubChem CID 58679874) has the molecular formula C4H11N2OTaTb-
and a molecular weight of 443.02 g/mol. Its IUPAC name is 1-(dimethylaminooxy)ethylazanide;tantalum;terbium.
Molecular Properties
| Compound Name | 1-(dimethylaminooxy)ethylazanide;tantalum;terbium |
| PubChem CID | 58679874 |
| Molecular Formula | C4H11N2OTaTb- |
| Molecular Weight | 443.02 g/mol |
| Exact Mass | 442.96 |
| IUPAC Name | 1-(dimethylaminooxy)ethylazanide;tantalum;terbium |
| SMILES | CC([NH-])ON(C)C.[Ta].[Tb] |
| InChI | InChI=1S/C4H11N2O.Ta.Tb/c1-4(5)7-6(2)3;;/h4-5H,1-3H3;;/q-1;; |
| InChIKey | ZLNDYOOUFWZMHW-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 36.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.02 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylaminooxy)ethylazanide;tantalum;terbium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylaminooxy)ethylazanide;tantalum;terbium?
The IUPAC name of 1-(dimethylaminooxy)ethylazanide;tantalum;terbium (CID 58679874) is 1-(dimethylaminooxy)ethylazanide;tantalum;terbium.
What is the SMILES notation for 1-(dimethylaminooxy)ethylazanide;tantalum;terbium?
The canonical SMILES for 1-(dimethylaminooxy)ethylazanide;tantalum;terbium is CC([NH-])ON(C)C.[Ta].[Tb].
What is the InChIKey of 1-(dimethylaminooxy)ethylazanide;tantalum;terbium?
The InChIKey is ZLNDYOOUFWZMHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N2O.Ta.Tb/c1-4(5)7-6(2)3;;/h4-5H,1-3H3;;/q-1;;.
What are the key properties of 1-(dimethylaminooxy)ethylazanide;tantalum;terbium?
1-(dimethylaminooxy)ethylazanide;tantalum;terbium has a molecular weight of 443.02 g/mol, XLogP of 0.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylaminooxy)ethylazanide;tantalum;terbium is sourced from PubChem (CID 58679874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).