About ethanamine;N-ethoxy-N-methylmethanamine
ethanamine;N-ethoxy-N-methylmethanamine (PubChem CID 87153998) has the molecular formula C6H18N2O
and a molecular weight of 134.22 g/mol. Its IUPAC name is ethanamine;N-ethoxy-N-methylmethanamine.
Molecular Properties
| Compound Name | ethanamine;N-ethoxy-N-methylmethanamine |
| PubChem CID | 87153998 |
| Molecular Formula | C6H18N2O |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.14 |
| IUPAC Name | ethanamine;N-ethoxy-N-methylmethanamine |
| SMILES | CCN.CCON(C)C |
| InChI | InChI=1S/C4H11NO.C2H7N/c1-4-6-5(2)3;1-2-3/h4H2,1-3H3;2-3H2,1H3 |
| InChIKey | USAMQTCCVVWMBT-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;N-ethoxy-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;N-ethoxy-N-methylmethanamine?
The IUPAC name of ethanamine;N-ethoxy-N-methylmethanamine (CID 87153998) is ethanamine;N-ethoxy-N-methylmethanamine.
What is the SMILES notation for ethanamine;N-ethoxy-N-methylmethanamine?
The canonical SMILES for ethanamine;N-ethoxy-N-methylmethanamine is CCN.CCON(C)C.
What is the InChIKey of ethanamine;N-ethoxy-N-methylmethanamine?
The InChIKey is USAMQTCCVVWMBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO.C2H7N/c1-4-6-5(2)3;1-2-3/h4H2,1-3H3;2-3H2,1H3.
What are the key properties of ethanamine;N-ethoxy-N-methylmethanamine?
ethanamine;N-ethoxy-N-methylmethanamine has a molecular weight of 134.22 g/mol, XLogP of 0.46, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;N-ethoxy-N-methylmethanamine is sourced from PubChem (CID 87153998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).