C27H29ClN4O2 — CID 58683675
N-(4-butan-2-ylphenyl)-2-(3-chloro-2-pyridinyl)-7-(2-methoxyethoxymethyl)-1,6-naphthyridin-5-amine (PubChem CID 58683675) has the molecular formula C27H29ClN4O2 and a molecular weight of 477.01 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-2-(3-chloro-2-pyridinyl)-7-(2-methoxyethoxymethyl)-1,6-naphthyridin-5-amine.
| Compound Name | N-(4-butan-2-ylphenyl)-2-(3-chloro-2-pyridinyl)-7-(2-methoxyethoxymethyl)-1,6-naphthyridin-5-amine |
|---|---|
| PubChem CID | 58683675 |
| Molecular Formula | C27H29ClN4O2 |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-2-(3-chloro-2-pyridinyl)-7-(2-methoxyethoxymethyl)-1,6-naphthyridin-5-amine |
| SMILES | CCC(C)c1ccc(Nc2nc(COCCOC)cc3nc(-c4ncccc4Cl)ccc23)cc1 |
| InChI | InChI=1S/C27H29ClN4O2/c1-4-18(2)19-7-9-20(10-8-19)30-27-22-11-12-24(26-23(28)6-5-13-29-26)32-25(22)16-21(31-27)17-34-15-14-33-3/h5-13,16,18H,4,14-15,17H2,1-3H3,(H,30,31) |
| InChIKey | BBJUWZYSXGNLMY-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|