C5H9Cl2NS — CID 58684760
2-(3,3-dichloroprop-2-enylsulfanyl)ethanamine (PubChem CID 58684760) has the molecular formula C5H9Cl2NS and a molecular weight of 186.11 g/mol. Its IUPAC name is 2-(3,3-dichloroprop-2-enylsulfanyl)ethanamine.
| Compound Name | 2-(3,3-dichloroprop-2-enylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 58684760 |
| Molecular Formula | C5H9Cl2NS |
| Molecular Weight | 186.11 g/mol |
| Exact Mass | 184.98 |
| IUPAC Name | 2-(3,3-dichloroprop-2-enylsulfanyl)ethanamine |
| SMILES | NCCSCC=C(Cl)Cl |
| InChI | InChI=1S/C5H9Cl2NS/c6-5(7)1-3-9-4-2-8/h1H,2-4,8H2 |
| InChIKey | VCWLWQXLYIDKCP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.11 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|