C25H25N7O2S — CID 58686319
6-N-[(5-ethylthiophen-3-yl)methyl]-4-N-[(1S)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide (PubChem CID 58686319) has the molecular formula C25H25N7O2S and a molecular weight of 487.59 g/mol. Its IUPAC name is 6-N-[(5-ethylthiophen-3-yl)methyl]-4-N-[(1S)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 6-N-[(5-ethylthiophen-3-yl)methyl]-4-N-[(1S)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 58686319 |
| Molecular Formula | C25H25N7O2S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 6-N-[(5-ethylthiophen-3-yl)methyl]-4-N-[(1S)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide |
| SMILES | CCc1cc(CNC(=O)c2cc(C(=O)N[C@H]3CCc4cc(-c5n[nH]c(C)n5)ccc43)ncn2)cs1 |
| InChI | InChI=1S/C25H25N7O2S/c1-3-18-8-15(12-35-18)11-26-24(33)21-10-22(28-13-27-21)25(34)30-20-7-5-16-9-17(4-6-19(16)20)23-29-14(2)31-32-23/h4,6,8-10,12-13,20H,3,5,7,11H2,1-2H3,(H,26,33)(H,30,34)(H,29,31,32)/t20-/m0/s1 |
| InChIKey | RBHLQQJWBOVKBY-FQEVSTJZSA-N |
| XLogP | 3.54 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |