C22H23F3N5O3+ — CID 58688766
imino-[2-[6-[methyl-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]amino]-3-pyridinyl]-2-oxoethylidene]azanium (PubChem CID 58688766) has the molecular formula C22H23F3N5O3+ and a molecular weight of 462.45 g/mol. Its IUPAC name is imino-[2-[6-[methyl-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]amino]-3-pyridinyl]-2-oxoethylidene]azanium.
| Compound Name | imino-[2-[6-[methyl-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]amino]-3-pyridinyl]-2-oxoethylidene]azanium |
|---|---|
| PubChem CID | 58688766 |
| Molecular Formula | C22H23F3N5O3+ |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | imino-[2-[6-[methyl-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]amino]-3-pyridinyl]-2-oxoethylidene]azanium |
| SMILES | CCCc1c(OCCCN(C)c2ccc(C(=O)C=[N+]=N)cn2)ccc2c(C(F)(F)F)noc12 |
| InChI | InChI=1S/C22H23F3N5O3/c1-3-5-15-18(8-7-16-20(15)33-29-21(16)22(23,24)25)32-11-4-10-30(2)19-9-6-14(12-27-19)17(31)13-28-26/h6-9,12-13,26H,3-5,10-11H2,1-2H3/q+1 |
| InChIKey | SQEDSKWMQJISIQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|