C12H16F3NO2S — CID 58691920
1,1-difluoro-3-[2-(4-fluorophenyl)propan-2-ylamino]propane-1-sulfinic acid (PubChem CID 58691920) has the molecular formula C12H16F3NO2S and a molecular weight of 295.33 g/mol. Its IUPAC name is 1,1-difluoro-3-[2-(4-fluorophenyl)propan-2-ylamino]propane-1-sulfinic acid.
| Compound Name | 1,1-difluoro-3-[2-(4-fluorophenyl)propan-2-ylamino]propane-1-sulfinic acid |
|---|---|
| PubChem CID | 58691920 |
| Molecular Formula | C12H16F3NO2S |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 1,1-difluoro-3-[2-(4-fluorophenyl)propan-2-ylamino]propane-1-sulfinic acid |
| SMILES | CC(C)(NCCC(F)(F)S(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H16F3NO2S/c1-11(2,9-3-5-10(13)6-4-9)16-8-7-12(14,15)19(17)18/h3-6,16H,7-8H2,1-2H3,(H,17,18) |
| InChIKey | JKLHQWPJPDFGDF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|