C24H28N4O3S2 — CID 58693906
N-[4-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]-2-thiomorpholin-4-ylethanesulfonamide (PubChem CID 58693906) has the molecular formula C24H28N4O3S2 and a molecular weight of 484.65 g/mol. Its IUPAC name is N-[4-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]-2-thiomorpholin-4-ylethanesulfonamide.
| Compound Name | N-[4-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]-2-thiomorpholin-4-ylethanesulfonamide |
|---|---|
| PubChem CID | 58693906 |
| Molecular Formula | C24H28N4O3S2 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | N-[4-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]-2-thiomorpholin-4-ylethanesulfonamide |
| SMILES | CCn1c(-c2ccc(NS(=O)(=O)CCN3CCSCC3)cc2)c(C#N)c2ccc(OC)cc21 |
| InChI | InChI=1S/C24H28N4O3S2/c1-3-28-23-16-20(31-2)8-9-21(23)22(17-25)24(28)18-4-6-19(7-5-18)26-33(29,30)15-12-27-10-13-32-14-11-27/h4-9,16,26H,3,10-15H2,1-2H3 |
| InChIKey | WIFJWDRJRFLBLD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |