C27H27N5O4S — CID 58694533
N-[4-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]-6-morpholin-4-ylpyridine-3-sulfonamide (PubChem CID 58694533) has the molecular formula C27H27N5O4S and a molecular weight of 517.61 g/mol. Its IUPAC name is N-[4-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]-6-morpholin-4-ylpyridine-3-sulfonamide.
| Compound Name | N-[4-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]-6-morpholin-4-ylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 58694533 |
| Molecular Formula | C27H27N5O4S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | N-[4-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]-6-morpholin-4-ylpyridine-3-sulfonamide |
| SMILES | CCn1c(-c2ccc(NS(=O)(=O)c3ccc(N4CCOCC4)nc3)cc2)c(C#N)c2ccc(OC)cc21 |
| InChI | InChI=1S/C27H27N5O4S/c1-3-32-25-16-21(35-2)8-10-23(25)24(17-28)27(32)19-4-6-20(7-5-19)30-37(33,34)22-9-11-26(29-18-22)31-12-14-36-15-13-31/h4-11,16,18,30H,3,12-15H2,1-2H3 |
| InChIKey | PFODTGNDJPGKTQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 109.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |