C24H23F2N3O4 — CID 58694127
2-methoxyethyl N-[4-[3-cyano-1-cyclobutyl-6-(difluoromethoxy)indol-2-yl]phenyl]carbamate (PubChem CID 58694127) has the molecular formula C24H23F2N3O4 and a molecular weight of 455.46 g/mol. Its IUPAC name is 2-methoxyethyl N-[4-[3-cyano-1-cyclobutyl-6-(difluoromethoxy)indol-2-yl]phenyl]carbamate.
| Compound Name | 2-methoxyethyl N-[4-[3-cyano-1-cyclobutyl-6-(difluoromethoxy)indol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 58694127 |
| Molecular Formula | C24H23F2N3O4 |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 2-methoxyethyl N-[4-[3-cyano-1-cyclobutyl-6-(difluoromethoxy)indol-2-yl]phenyl]carbamate |
| SMILES | COCCOC(=O)Nc1ccc(-c2c(C#N)c3ccc(OC(F)F)cc3n2C2CCC2)cc1 |
| InChI | InChI=1S/C24H23F2N3O4/c1-31-11-12-32-24(30)28-16-7-5-15(6-8-16)22-20(14-27)19-10-9-18(33-23(25)26)13-21(19)29(22)17-3-2-4-17/h5-10,13,17,23H,2-4,11-12H2,1H3,(H,28,30) |
| InChIKey | QBMPAAUWKPJFQC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|