C23H21ClN4O2 — CID 58694440
1-(2-chloroethyl)-3-[3-[2-(3-cyano-1-ethyl-6-methoxyindol-2-yl)ethynyl]phenyl]urea (PubChem CID 58694440) has the molecular formula C23H21ClN4O2 and a molecular weight of 420.90 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[3-[2-(3-cyano-1-ethyl-6-methoxyindol-2-yl)ethynyl]phenyl]urea.
| Compound Name | 1-(2-chloroethyl)-3-[3-[2-(3-cyano-1-ethyl-6-methoxyindol-2-yl)ethynyl]phenyl]urea |
|---|---|
| PubChem CID | 58694440 |
| Molecular Formula | C23H21ClN4O2 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 1-(2-chloroethyl)-3-[3-[2-(3-cyano-1-ethyl-6-methoxyindol-2-yl)ethynyl]phenyl]urea |
| SMILES | CCn1c(C#Cc2cccc(NC(=O)NCCCl)c2)c(C#N)c2ccc(OC)cc21 |
| InChI | InChI=1S/C23H21ClN4O2/c1-3-28-21(20(15-25)19-9-8-18(30-2)14-22(19)28)10-7-16-5-4-6-17(13-16)27-23(29)26-12-11-24/h4-6,8-9,13-14H,3,11-12H2,1-2H3,(H2,26,27,29) |
| InChIKey | XKQATMJXQOAVAW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|