C67H67IrN2O2- — CID 58695301
iridium;9-[4-[4-(3-octyl-9H-fluoren-9-yl)phenyl]phenyl]-3-[6-(4-pyridin-2-ylbenzene-5-id-1-yl)hexyl]carbazole;pentane-2,4-dione (PubChem CID 58695301) has the molecular formula C67H67IrN2O2- and a molecular weight of 1124.50 g/mol. Its IUPAC name is iridium;9-[4-[4-(3-octyl-9H-fluoren-9-yl)phenyl]phenyl]-3-[6-(4-pyridin-2-ylbenzene-5-id-1-yl)hexyl]carbazole;pentane-2,4-dione.
| Compound Name | iridium;9-[4-[4-(3-octyl-9H-fluoren-9-yl)phenyl]phenyl]-3-[6-(4-pyridin-2-ylbenzene-5-id-1-yl)hexyl]carbazole;pentane-2,4-dione |
|---|---|
| PubChem CID | 58695301 |
| Molecular Formula | C67H67IrN2O2- |
| Molecular Weight | 1124.50 g/mol |
| Exact Mass | 1124.48 |
| IUPAC Name | iridium;9-[4-[4-(3-octyl-9H-fluoren-9-yl)phenyl]phenyl]-3-[6-(4-pyridin-2-ylbenzene-5-id-1-yl)hexyl]carbazole;pentane-2,4-dione |
| SMILES | CC(=O)CC(C)=O.CCCCCCCCc1ccc2c(c1)-c1ccccc1C2c1ccc(-c2ccc(-n3c4ccccc4c4cc(CCCCCCc5c[c-]c(-c6ccccn6)cc5)ccc43)cc2)cc1.[Ir] |
| InChI | InChI=1S/C62H59N2.C5H8O2.Ir/c1-2-3-4-5-6-10-19-46-28-40-56-57(43-46)53-21-12-13-23-55(53)62(56)51-34-32-48(33-35-51)49-36-38-52(39-37-49)64-60-25-15-14-22-54(60)58-44-47(29-41-61(58)64)20-11-8-7-9-18-45-26-30-50(31-27-45)59-24-16-17-42-63-59;1-4(6)3-5(2)7;/h12-17,21-30,32-44,62H,2-11,18-20H2,1H3;3H2,1-2H3;/q-1;; |
| InChIKey | ZGVQVOTUWARVHP-UHFFFAOYSA-N |
| XLogP | 17.27 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1124.50 |
| LogP ≤ 5 | 17.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|