About CID 58696087
CID 58696087 (PubChem CID 58696087) has the molecular formula C9H18N+
and a molecular weight of 140.25 g/mol.
Molecular Properties
| Compound Name | CID 58696087 |
| PubChem CID | 58696087 |
| Molecular Formula | C9H18N+ |
| Molecular Weight | 140.25 g/mol |
| Exact Mass | 140.14 |
| IUPAC Name | — |
| SMILES | [CH][N+]1(CCC)CCCCC1 |
| InChI | InChI=1S/C9H18N/c1-3-7-10(2)8-5-4-6-9-10/h2H,3-9H2,1H3/q+1 |
| InChIKey | UDWWUMWSMSMVQB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze CID 58696087 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58696087?
The IUPAC name of CID 58696087 (CID 58696087) is not available.
What is the SMILES notation for CID 58696087?
The canonical SMILES for CID 58696087 is [CH][N+]1(CCC)CCCCC1.
What is the InChIKey of CID 58696087?
The InChIKey is UDWWUMWSMSMVQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N/c1-3-7-10(2)8-5-4-6-9-10/h2H,3-9H2,1H3/q+1.
What are the key properties of CID 58696087?
CID 58696087 has a molecular weight of 140.25 g/mol, XLogP of 2.07, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58696087 is sourced from PubChem (CID 58696087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).