About N-(2-cyclopentylprop-2-enyl)ethanimine;tungsten
N-(2-cyclopentylprop-2-enyl)ethanimine;tungsten (PubChem CID 58696114) has the molecular formula C10H16NW-
and a molecular weight of 334.09 g/mol. Its IUPAC name is N-(2-cyclopentylprop-2-enyl)ethanimine;tungsten.
Molecular Properties
| Compound Name | N-(2-cyclopentylprop-2-enyl)ethanimine;tungsten |
| PubChem CID | 58696114 |
| Molecular Formula | C10H16NW- |
| Molecular Weight | 334.09 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-(2-cyclopentylprop-2-enyl)ethanimine;tungsten |
| SMILES | C=C(C/N=C/C)[C@@H]1C[CH-]CC1.[W] |
| InChI | InChI=1S/C10H16N.W/c1-3-11-8-9(2)10-6-4-5-7-10;/h3-4,10H,2,5-8H2,1H3;/q-1;/b11-3+;/t10-;/m1./s1 |
| InChIKey | KBSOOYVUOKDHER-MQQZZRNZSA-N |
| XLogP | 2.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.09 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-cyclopentylprop-2-enyl)ethanimine;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyclopentylprop-2-enyl)ethanimine;tungsten?
The IUPAC name of N-(2-cyclopentylprop-2-enyl)ethanimine;tungsten (CID 58696114) is N-(2-cyclopentylprop-2-enyl)ethanimine;tungsten.
What is the SMILES notation for N-(2-cyclopentylprop-2-enyl)ethanimine;tungsten?
The canonical SMILES for N-(2-cyclopentylprop-2-enyl)ethanimine;tungsten is C=C(C/N=C/C)[C@@H]1C[CH-]CC1.[W].
What is the InChIKey of N-(2-cyclopentylprop-2-enyl)ethanimine;tungsten?
The InChIKey is KBSOOYVUOKDHER-MQQZZRNZSA-N. The full InChI is InChI=1S/C10H16N.W/c1-3-11-8-9(2)10-6-4-5-7-10;/h3-4,10H,2,5-8H2,1H3;/q-1;/b11-3+;/t10-;/m1./s1.
What are the key properties of N-(2-cyclopentylprop-2-enyl)ethanimine;tungsten?
N-(2-cyclopentylprop-2-enyl)ethanimine;tungsten has a molecular weight of 334.09 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyclopentylprop-2-enyl)ethanimine;tungsten is sourced from PubChem (CID 58696114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).