C11H19N — CID 163514435
(5S,7R)-7-ethyl-5-methyl-3-methylidene-4,5,6,7-tetrahydro-2H-azocine (PubChem CID 163514435) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (5S,7R)-7-ethyl-5-methyl-3-methylidene-4,5,6,7-tetrahydro-2H-azocine.
| Compound Name | (5S,7R)-7-ethyl-5-methyl-3-methylidene-4,5,6,7-tetrahydro-2H-azocine |
|---|---|
| PubChem CID | 163514435 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (5S,7R)-7-ethyl-5-methyl-3-methylidene-4,5,6,7-tetrahydro-2H-azocine |
| SMILES | C=C1C/N=C\[C@H](CC)C[C@H](C)C1 |
| InChI | InChI=1S/C11H19N/c1-4-11-6-9(2)5-10(3)7-12-8-11/h8-9,11H,3-7H2,1-2H3/b12-8-/t9-,11-/m1/s1 |
| InChIKey | DFMHDANQKQJNEK-AETSXSFXSA-N |
| XLogP | 3.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|