C17H25NO6 — CID 58701535
9-[[(2-methoxyphenyl)methylamino]methyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol (PubChem CID 58701535) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is 9-[[(2-methoxyphenyl)methylamino]methyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol.
| Compound Name | 9-[[(2-methoxyphenyl)methylamino]methyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol |
|---|---|
| PubChem CID | 58701535 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 9-[[(2-methoxyphenyl)methylamino]methyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol |
| SMILES | COc1ccccc1CNCC1OC2OCCCOC1C(O)C2O |
| InChI | InChI=1S/C17H25NO6/c1-21-12-6-3-2-5-11(12)9-18-10-13-16-14(19)15(20)17(24-13)23-8-4-7-22-16/h2-3,5-6,13-20H,4,7-10H2,1H3 |
| InChIKey | ZJLHLHHYFATZMJ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 89.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |