C14H19NO4 — CID 95003278
2-[2-[[[(2R)-oxolan-2-yl]methylamino]methyl]phenoxy]acetic acid (PubChem CID 95003278) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-[2-[[[(2R)-oxolan-2-yl]methylamino]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[[[(2R)-oxolan-2-yl]methylamino]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 95003278 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2-[2-[[[(2R)-oxolan-2-yl]methylamino]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1CNC[C@H]1CCCO1 |
| InChI | InChI=1S/C14H19NO4/c16-14(17)10-19-13-6-2-1-4-11(13)8-15-9-12-5-3-7-18-12/h1-2,4,6,12,15H,3,5,7-10H2,(H,16,17)/t12-/m1/s1 |
| InChIKey | WOSGSYLMGHULJX-GFCCVEGCSA-N |
| XLogP | 1.42 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |