C22H26N2O5 — CID 122030533
4-[[[2-[2-oxo-2-(oxolan-2-ylmethylamino)ethoxy]phenyl]methylamino]methyl]benzoic acid (PubChem CID 122030533) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 4-[[[2-[2-oxo-2-(oxolan-2-ylmethylamino)ethoxy]phenyl]methylamino]methyl]benzoic acid.
| Compound Name | 4-[[[2-[2-oxo-2-(oxolan-2-ylmethylamino)ethoxy]phenyl]methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122030533 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 4-[[[2-[2-oxo-2-(oxolan-2-ylmethylamino)ethoxy]phenyl]methylamino]methyl]benzoic acid |
| SMILES | O=C(COc1ccccc1CNCc1ccc(C(=O)O)cc1)NCC1CCCO1 |
| InChI | InChI=1S/C22H26N2O5/c25-21(24-14-19-5-3-11-28-19)15-29-20-6-2-1-4-18(20)13-23-12-16-7-9-17(10-8-16)22(26)27/h1-2,4,6-10,19,23H,3,5,11-15H2,(H,24,25)(H,26,27) |
| InChIKey | BPBSUBMRXXTJFT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |