C18H30NO4P — CID 58701778
2-diethoxyphosphoryl-N-[1-[4-(2-methylpropyl)phenyl]ethyl]acetamide (PubChem CID 58701778) has the molecular formula C18H30NO4P and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-N-[1-[4-(2-methylpropyl)phenyl]ethyl]acetamide.
| Compound Name | 2-diethoxyphosphoryl-N-[1-[4-(2-methylpropyl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 58701778 |
| Molecular Formula | C18H30NO4P |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-diethoxyphosphoryl-N-[1-[4-(2-methylpropyl)phenyl]ethyl]acetamide |
| SMILES | CCOP(=O)(CC(=O)NC(C)c1ccc(CC(C)C)cc1)OCC |
| InChI | InChI=1S/C18H30NO4P/c1-6-22-24(21,23-7-2)13-18(20)19-15(5)17-10-8-16(9-11-17)12-14(3)4/h8-11,14-15H,6-7,12-13H2,1-5H3,(H,19,20) |
| InChIKey | RWOXQYBCCVKKJY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|