C33H33N5O5 — CID 58702162
ethyl 2-[4-[naphthalene-2-carbonyl-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]carbamoyl]piperidin-1-yl]-2-oxoacetate (PubChem CID 58702162) has the molecular formula C33H33N5O5 and a molecular weight of 579.66 g/mol. Its IUPAC name is ethyl 2-[4-[naphthalene-2-carbonyl-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]carbamoyl]piperidin-1-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[4-[naphthalene-2-carbonyl-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]carbamoyl]piperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 58702162 |
| Molecular Formula | C33H33N5O5 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | ethyl 2-[4-[naphthalene-2-carbonyl-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]carbamoyl]piperidin-1-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N1CCC(C(=O)N(C(=O)c2ccc3ccccc3c2)c2ccnc(N[C@@H](C)c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C33H33N5O5/c1-3-43-32(42)31(41)37-19-16-25(17-20-37)29(39)38(30(40)27-14-13-24-11-7-8-12-26(24)21-27)28-15-18-34-33(36-28)35-22(2)23-9-5-4-6-10-23/h4-15,18,21-22,25H,3,16-17,19-20H2,1-2H3,(H,34,35,36)/t22-/m0/s1 |
| InChIKey | UURAQNLFVKYWKX-QFIPXVFZSA-N |
| XLogP | 4.78 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|