C21H20ClFN4O — CID 58702480
3-chloro-N-ethyl-2-fluoro-N-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]benzamide (PubChem CID 58702480) has the molecular formula C21H20ClFN4O and a molecular weight of 398.87 g/mol. Its IUPAC name is 3-chloro-N-ethyl-2-fluoro-N-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]benzamide.
| Compound Name | 3-chloro-N-ethyl-2-fluoro-N-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 58702480 |
| Molecular Formula | C21H20ClFN4O |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 3-chloro-N-ethyl-2-fluoro-N-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]benzamide |
| SMILES | CCN(C(=O)c1cccc(Cl)c1F)c1ccnc(N[C@@H](C)c2ccccc2)n1 |
| InChI | InChI=1S/C21H20ClFN4O/c1-3-27(20(28)16-10-7-11-17(22)19(16)23)18-12-13-24-21(26-18)25-14(2)15-8-5-4-6-9-15/h4-14H,3H2,1-2H3,(H,24,25,26)/t14-/m0/s1 |
| InChIKey | MVKYYIJKXYYYCY-AWEZNQCLSA-N |
| XLogP | 5.11 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |