C21H22ClF3N2O2 — CID 58702993
1-(1-chlorobutan-2-yl)-5-[2-methoxy-4-(trifluoromethoxy)phenyl]-3,6-dimethylpyrrolo[3,2-b]pyridine (PubChem CID 58702993) has the molecular formula C21H22ClF3N2O2 and a molecular weight of 426.87 g/mol. Its IUPAC name is 1-(1-chlorobutan-2-yl)-5-[2-methoxy-4-(trifluoromethoxy)phenyl]-3,6-dimethylpyrrolo[3,2-b]pyridine.
| Compound Name | 1-(1-chlorobutan-2-yl)-5-[2-methoxy-4-(trifluoromethoxy)phenyl]-3,6-dimethylpyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 58702993 |
| Molecular Formula | C21H22ClF3N2O2 |
| Molecular Weight | 426.87 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 1-(1-chlorobutan-2-yl)-5-[2-methoxy-4-(trifluoromethoxy)phenyl]-3,6-dimethylpyrrolo[3,2-b]pyridine |
| SMILES | CCC(CCl)n1cc(C)c2nc(-c3ccc(OC(F)(F)F)cc3OC)c(C)cc21 |
| InChI | InChI=1S/C21H22ClF3N2O2/c1-5-14(10-22)27-11-13(3)20-17(27)8-12(2)19(26-20)16-7-6-15(9-18(16)28-4)29-21(23,24)25/h6-9,11,14H,5,10H2,1-4H3 |
| InChIKey | PSDREHBPEVJWGI-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.87 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|