C17H13N3 — CID 58704078
4-methyl-8-phenyl-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 58704078) has the molecular formula C17H13N3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-methyl-8-phenyl-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 4-methyl-8-phenyl-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 58704078 |
| Molecular Formula | C17H13N3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 4-methyl-8-phenyl-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cc1ccc2c(n1)c1ncccc1n2-c1ccccc1 |
| InChI | InChI=1S/C17H13N3/c1-12-9-10-15-17(19-12)16-14(8-5-11-18-16)20(15)13-6-3-2-4-7-13/h2-11H,1H3 |
| InChIKey | NKVHRYRAUBYZJW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |