C24H16N4PtS — CID 58704093
N-phenyl-6-(2H-pyrrol-2-id-1-yl)-N-[3-(1,3-thiazol-2-yl)benzene-2-id-1-yl]pyridin-2-amine;platinum(2+) (PubChem CID 58704093) has the molecular formula C24H16N4PtS and a molecular weight of 587.57 g/mol. Its IUPAC name is N-phenyl-6-(2H-pyrrol-2-id-1-yl)-N-[3-(1,3-thiazol-2-yl)benzene-2-id-1-yl]pyridin-2-amine;platinum(2+).
| Compound Name | N-phenyl-6-(2H-pyrrol-2-id-1-yl)-N-[3-(1,3-thiazol-2-yl)benzene-2-id-1-yl]pyridin-2-amine;platinum(2+) |
|---|---|
| PubChem CID | 58704093 |
| Molecular Formula | C24H16N4PtS |
| Molecular Weight | 587.57 g/mol |
| Exact Mass | 587.07 |
| IUPAC Name | N-phenyl-6-(2H-pyrrol-2-id-1-yl)-N-[3-(1,3-thiazol-2-yl)benzene-2-id-1-yl]pyridin-2-amine;platinum(2+) |
| SMILES | [Pt+2].[c-]1c(-c2nccs2)cccc1N(c1ccccc1)c1cccc(-n2[c-]ccc2)n1 |
| InChI | InChI=1S/C24H16N4S.Pt/c1-2-9-20(10-3-1)28(21-11-6-8-19(18-21)24-25-14-17-29-24)23-13-7-12-22(26-23)27-15-4-5-16-27;/h1-15,17H;/q-2;+2 |
| InChIKey | ISSRVZRVYFSHJA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.57 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|