C29H23N5 — CID 58704225
3-(1-methylbenzimidazol-2-yl)-N-phenyl-N-(3-pyrazol-1-ylphenyl)aniline (PubChem CID 58704225) has the molecular formula C29H23N5 and a molecular weight of 441.54 g/mol. Its IUPAC name is 3-(1-methylbenzimidazol-2-yl)-N-phenyl-N-(3-pyrazol-1-ylphenyl)aniline.
| Compound Name | 3-(1-methylbenzimidazol-2-yl)-N-phenyl-N-(3-pyrazol-1-ylphenyl)aniline |
|---|---|
| PubChem CID | 58704225 |
| Molecular Formula | C29H23N5 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 3-(1-methylbenzimidazol-2-yl)-N-phenyl-N-(3-pyrazol-1-ylphenyl)aniline |
| SMILES | Cn1c(-c2cccc(N(c3ccccc3)c3cccc(-n4cccn4)c3)c2)nc2ccccc21 |
| InChI | InChI=1S/C29H23N5/c1-32-28-17-6-5-16-27(28)31-29(32)22-10-7-14-25(20-22)34(23-11-3-2-4-12-23)26-15-8-13-24(21-26)33-19-9-18-30-33/h2-21H,1H3 |
| InChIKey | VMLBAESBVRGQHS-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |