C27H45N5O6S — CID 58705637
(1R,2S,5S)-N-[(3S)-1-(but-3-enylamino)-1,2-dioxohept-6-en-3-yl]-3-[(2S)-2-(dimethylsulfamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 58705637) has the molecular formula C27H45N5O6S and a molecular weight of 567.75 g/mol. Its IUPAC name is (1R,2S,5S)-N-[(3S)-1-(but-3-enylamino)-1,2-dioxohept-6-en-3-yl]-3-[(2S)-2-(dimethylsulfamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-[(3S)-1-(but-3-enylamino)-1,2-dioxohept-6-en-3-yl]-3-[(2S)-2-(dimethylsulfamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 58705637 |
| Molecular Formula | C27H45N5O6S |
| Molecular Weight | 567.75 g/mol |
| Exact Mass | 567.31 |
| IUPAC Name | (1R,2S,5S)-N-[(3S)-1-(but-3-enylamino)-1,2-dioxohept-6-en-3-yl]-3-[(2S)-2-(dimethylsulfamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | C=CCCNC(=O)C(=O)[C@H](CCC=C)NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NS(=O)(=O)N(C)C)C(C)(C)C)C2(C)C |
| InChI | InChI=1S/C27H45N5O6S/c1-10-12-14-18(21(33)24(35)28-15-13-11-2)29-23(34)20-19-17(27(19,6)7)16-32(20)25(36)22(26(3,4)5)30-39(37,38)31(8)9/h10-11,17-20,22,30H,1-2,12-16H2,3-9H3,(H,28,35)(H,29,34)/t17-,18-,19-,20-,22+/m0/s1 |
| InChIKey | KNDGUGPEWXNHFU-SPNOPHAYSA-N |
| XLogP | 0.99 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.75 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|