C19H20N4O2S — CID 58706821
2-[(E)-1-[5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]thiophen-2-yl]ethylideneamino]oxyethanol (PubChem CID 58706821) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-[(E)-1-[5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]thiophen-2-yl]ethylideneamino]oxyethanol.
| Compound Name | 2-[(E)-1-[5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]thiophen-2-yl]ethylideneamino]oxyethanol |
|---|---|
| PubChem CID | 58706821 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-[(E)-1-[5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]thiophen-2-yl]ethylideneamino]oxyethanol |
| SMILES | C/C(=N\OCCO)c1ccc(-c2cccc(Nc3cc(C)ccn3)n2)s1 |
| InChI | InChI=1S/C19H20N4O2S/c1-13-8-9-20-19(12-13)22-18-5-3-4-15(21-18)17-7-6-16(26-17)14(2)23-25-11-10-24/h3-9,12,24H,10-11H2,1-2H3,(H,20,21,22)/b23-14+ |
| InChIKey | XAVOGLCRPLULKT-OEAKJJBVSA-N |
| XLogP | 3.99 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|