C20H21N5S — CID 58707057
5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]-N,N-bis(prop-2-enyl)-1,3-thiazol-2-amine (PubChem CID 58707057) has the molecular formula C20H21N5S and a molecular weight of 363.49 g/mol. Its IUPAC name is 5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]-N,N-bis(prop-2-enyl)-1,3-thiazol-2-amine.
| Compound Name | 5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]-N,N-bis(prop-2-enyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58707057 |
| Molecular Formula | C20H21N5S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]-N,N-bis(prop-2-enyl)-1,3-thiazol-2-amine |
| SMILES | C=CCN(CC=C)c1ncc(-c2cccc(Nc3cc(C)ccn3)n2)s1 |
| InChI | InChI=1S/C20H21N5S/c1-4-11-25(12-5-2)20-22-14-17(26-20)16-7-6-8-18(23-16)24-19-13-15(3)9-10-21-19/h4-10,13-14H,1-2,11-12H2,3H3,(H,21,23,24) |
| InChIKey | MMATYMDMMHDMGL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|