C20H23N5O2S — CID 58706934
5-[methyl-[5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]-1,3-thiazol-2-yl]amino]pentanoic acid (PubChem CID 58706934) has the molecular formula C20H23N5O2S and a molecular weight of 397.50 g/mol. Its IUPAC name is 5-[methyl-[5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]-1,3-thiazol-2-yl]amino]pentanoic acid.
| Compound Name | 5-[methyl-[5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]-1,3-thiazol-2-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 58706934 |
| Molecular Formula | C20H23N5O2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 5-[methyl-[5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]-1,3-thiazol-2-yl]amino]pentanoic acid |
| SMILES | Cc1ccnc(Nc2cccc(-c3cnc(N(C)CCCCC(=O)O)s3)n2)c1 |
| InChI | InChI=1S/C20H23N5O2S/c1-14-9-10-21-18(12-14)24-17-7-5-6-15(23-17)16-13-22-20(28-16)25(2)11-4-3-8-19(26)27/h5-7,9-10,12-13H,3-4,8,11H2,1-2H3,(H,26,27)(H,21,23,24) |
| InChIKey | AEDXCLCRIHPPDL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|