C24H25N5O2S — CID 163769540
[4-[2-[methyl-[5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]-1,3-thiazol-2-yl]amino]ethyl]phenyl]methanediol (PubChem CID 163769540) has the molecular formula C24H25N5O2S and a molecular weight of 447.56 g/mol. Its IUPAC name is [4-[2-[methyl-[5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]-1,3-thiazol-2-yl]amino]ethyl]phenyl]methanediol.
| Compound Name | [4-[2-[methyl-[5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]-1,3-thiazol-2-yl]amino]ethyl]phenyl]methanediol |
|---|---|
| PubChem CID | 163769540 |
| Molecular Formula | C24H25N5O2S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | [4-[2-[methyl-[5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]-1,3-thiazol-2-yl]amino]ethyl]phenyl]methanediol |
| SMILES | Cc1ccnc(Nc2cccc(-c3cnc(N(C)CCc4ccc(C(O)O)cc4)s3)n2)c1 |
| InChI | InChI=1S/C24H25N5O2S/c1-16-10-12-25-22(14-16)28-21-5-3-4-19(27-21)20-15-26-24(32-20)29(2)13-11-17-6-8-18(9-7-17)23(30)31/h3-10,12,14-15,23,30-31H,11,13H2,1-2H3,(H,25,27,28) |
| InChIKey | MFFWKULIFAOTQN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|