C16H34N2 — CID 58707411
4-N-tert-butyl-1-N-(2-ethylbutyl)cyclohexane-1,4-diamine (PubChem CID 58707411) has the molecular formula C16H34N2 and a molecular weight of 254.46 g/mol. Its IUPAC name is 4-N-tert-butyl-1-N-(2-ethylbutyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-tert-butyl-1-N-(2-ethylbutyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 58707411 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | 4-N-tert-butyl-1-N-(2-ethylbutyl)cyclohexane-1,4-diamine |
| SMILES | CCC(CC)CNC1CCC(NC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H34N2/c1-6-13(7-2)12-17-14-8-10-15(11-9-14)18-16(3,4)5/h13-15,17-18H,6-12H2,1-5H3 |
| InChIKey | NDGYPXPPXLUZQQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |