C27H37N5O3Si — CID 58707502
3-[1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrazol-3-yl]-4-(1-butylpyrrolo[2,3-b]pyridin-3-yl)pyrrole-2,5-dione (PubChem CID 58707502) has the molecular formula C27H37N5O3Si and a molecular weight of 507.71 g/mol. Its IUPAC name is 3-[1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrazol-3-yl]-4-(1-butylpyrrolo[2,3-b]pyridin-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrazol-3-yl]-4-(1-butylpyrrolo[2,3-b]pyridin-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 58707502 |
| Molecular Formula | C27H37N5O3Si |
| Molecular Weight | 507.71 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | 3-[1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrazol-3-yl]-4-(1-butylpyrrolo[2,3-b]pyridin-3-yl)pyrrole-2,5-dione |
| SMILES | CCCCn1cc(C2=C(c3ccn(CCCO[Si](C)(C)C(C)(C)C)n3)C(=O)NC2=O)c2cccnc21 |
| InChI | InChI=1S/C27H37N5O3Si/c1-7-8-14-31-18-20(19-11-9-13-28-24(19)31)22-23(26(34)29-25(22)33)21-12-16-32(30-21)15-10-17-35-36(5,6)27(2,3)4/h9,11-13,16,18H,7-8,10,14-15,17H2,1-6H3,(H,29,33,34) |
| InChIKey | FYCGKUQXHVKQJK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.71 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|