C29H25N2OS2+ — CID 58708559
(2Z)-2-[(E)-2-(1-benzofuran-2-yl)-3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-ethyl-1,3-benzothiazole (PubChem CID 58708559) has the molecular formula C29H25N2OS2+ and a molecular weight of 481.67 g/mol. Its IUPAC name is (2Z)-2-[(E)-2-(1-benzofuran-2-yl)-3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-ethyl-1,3-benzothiazole.
| Compound Name | (2Z)-2-[(E)-2-(1-benzofuran-2-yl)-3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-ethyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 58708559 |
| Molecular Formula | C29H25N2OS2+ |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | (2Z)-2-[(E)-2-(1-benzofuran-2-yl)-3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-ethyl-1,3-benzothiazole |
| SMILES | CCN1/C(=C/C(=C\c2sc3ccccc3[n+]2CC)c2cc3ccccc3o2)Sc2ccccc21 |
| InChI | InChI=1S/C29H25N2OS2/c1-3-30-22-12-6-9-15-26(22)33-28(30)18-21(25-17-20-11-5-8-14-24(20)32-25)19-29-31(4-2)23-13-7-10-16-27(23)34-29/h5-19H,3-4H2,1-2H3/q+1 |
| InChIKey | PHFBKGCXWUYRSE-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|