C25H22N2O2PPt- — CID 58709037
phenyl-[2-[6-(3-pyridin-2-yloxybenzene-2-id-1-yl)oxy-2-pyridinyl]propan-2-yl]phosphane;platinum (PubChem CID 58709037) has the molecular formula C25H22N2O2PPt- and a molecular weight of 608.52 g/mol. Its IUPAC name is phenyl-[2-[6-(3-pyridin-2-yloxybenzene-2-id-1-yl)oxy-2-pyridinyl]propan-2-yl]phosphane;platinum.
| Compound Name | phenyl-[2-[6-(3-pyridin-2-yloxybenzene-2-id-1-yl)oxy-2-pyridinyl]propan-2-yl]phosphane;platinum |
|---|---|
| PubChem CID | 58709037 |
| Molecular Formula | C25H22N2O2PPt- |
| Molecular Weight | 608.52 g/mol |
| Exact Mass | 608.11 |
| IUPAC Name | phenyl-[2-[6-(3-pyridin-2-yloxybenzene-2-id-1-yl)oxy-2-pyridinyl]propan-2-yl]phosphane;platinum |
| SMILES | CC(C)(Pc1ccccc1)c1cccc(Oc2[c-]c(Oc3ccccn3)ccc2)n1.[Pt] |
| InChI | InChI=1S/C25H22N2O2P.Pt/c1-25(2,30-21-12-4-3-5-13-21)22-14-9-16-24(27-22)29-20-11-8-10-19(18-20)28-23-15-6-7-17-26-23;/h3-17,30H,1-2H3;/q-1; |
| InChIKey | SLYVDFJGTGVAHF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.52 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|