C11H4F2N4OS — CID 58712290
5-(3,5-difluoro-4-isocyanoanilino)-3-oxo-1,2-thiazole-4-carbonitrile (PubChem CID 58712290) has the molecular formula C11H4F2N4OS and a molecular weight of 278.24 g/mol. Its IUPAC name is 5-(3,5-difluoro-4-isocyanoanilino)-3-oxo-1,2-thiazole-4-carbonitrile.
| Compound Name | 5-(3,5-difluoro-4-isocyanoanilino)-3-oxo-1,2-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 58712290 |
| Molecular Formula | C11H4F2N4OS |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 5-(3,5-difluoro-4-isocyanoanilino)-3-oxo-1,2-thiazole-4-carbonitrile |
| SMILES | [C-]#[N+]c1c(F)cc(Nc2s[nH]c(=O)c2C#N)cc1F |
| InChI | InChI=1S/C11H4F2N4OS/c1-15-9-7(12)2-5(3-8(9)13)16-11-6(4-14)10(18)17-19-11/h2-3,16H,(H,17,18) |
| InChIKey | VFGWTQCVROKIIX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 73.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|