C44H52Br2IrNO2S- — CID 58713555
2-(3H-1-benzothiophen-3-id-2-yl)pyridine;12-(2,7-dibromo-9-hexylfluoren-9-yl)dodecane-2,4-diol;iridium (PubChem CID 58713555) has the molecular formula C44H52Br2IrNO2S- and a molecular weight of 1011.00 g/mol. Its IUPAC name is 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;12-(2,7-dibromo-9-hexylfluoren-9-yl)dodecane-2,4-diol;iridium.
| Compound Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;12-(2,7-dibromo-9-hexylfluoren-9-yl)dodecane-2,4-diol;iridium |
|---|---|
| PubChem CID | 58713555 |
| Molecular Formula | C44H52Br2IrNO2S- |
| Molecular Weight | 1011.00 g/mol |
| Exact Mass | 1009.17 |
| IUPAC Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;12-(2,7-dibromo-9-hexylfluoren-9-yl)dodecane-2,4-diol;iridium |
| SMILES | CCCCCCC1(CCCCCCCCC(O)CC(C)O)c2cc(Br)ccc2-c2ccc(Br)cc21.[Ir].[c-]1c(-c2ccccn2)sc2ccccc12 |
| InChI | InChI=1S/C31H44Br2O2.C13H8NS.Ir/c1-3-4-5-11-18-31(19-12-9-7-6-8-10-13-26(35)20-23(2)34)29-21-24(32)14-16-27(29)28-17-15-25(33)22-30(28)31;1-2-7-12-10(5-1)9-13(15-12)11-6-3-4-8-14-11;/h14-17,21-23,26,34-35H,3-13,18-20H2,1-2H3;1-8H;/q;-1; |
| InChIKey | USMGMMHPZLYZOF-UHFFFAOYSA-N |
| XLogP | 13.46 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1011.00 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|