C42H52Br2IrNO2- — CID 58713553
12-(2,7-dibromo-9-hexylfluoren-9-yl)dodecane-2,4-diol;iridium;2-phenylpyridine (PubChem CID 58713553) has the molecular formula C42H52Br2IrNO2- and a molecular weight of 954.91 g/mol. Its IUPAC name is 12-(2,7-dibromo-9-hexylfluoren-9-yl)dodecane-2,4-diol;iridium;2-phenylpyridine.
| Compound Name | 12-(2,7-dibromo-9-hexylfluoren-9-yl)dodecane-2,4-diol;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 58713553 |
| Molecular Formula | C42H52Br2IrNO2- |
| Molecular Weight | 954.91 g/mol |
| Exact Mass | 953.20 |
| IUPAC Name | 12-(2,7-dibromo-9-hexylfluoren-9-yl)dodecane-2,4-diol;iridium;2-phenylpyridine |
| SMILES | CCCCCCC1(CCCCCCCCC(O)CC(C)O)c2cc(Br)ccc2-c2ccc(Br)cc21.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C31H44Br2O2.C11H8N.Ir/c1-3-4-5-11-18-31(19-12-9-7-6-8-10-13-26(35)20-23(2)34)29-21-24(32)14-16-27(29)28-17-15-25(33)22-30(28)31;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h14-17,21-23,26,34-35H,3-13,18-20H2,1-2H3;1-6,8-9H;/q;-1; |
| InChIKey | VOMYQYRAWGEKHU-UHFFFAOYSA-N |
| XLogP | 12.25 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 954.91 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|