C37H46IrNO2- — CID 168745351
2-(11,11-dimethyl-8H-benzo[a]fluoren-8-id-9-yl)pyridine;iridium;3,3,7,7-tetramethylnonane-4,6-diol (PubChem CID 168745351) has the molecular formula C37H46IrNO2- and a molecular weight of 729.00 g/mol. Its IUPAC name is 2-(11,11-dimethyl-8H-benzo[a]fluoren-8-id-9-yl)pyridine;iridium;3,3,7,7-tetramethylnonane-4,6-diol.
| Compound Name | 2-(11,11-dimethyl-8H-benzo[a]fluoren-8-id-9-yl)pyridine;iridium;3,3,7,7-tetramethylnonane-4,6-diol |
|---|---|
| PubChem CID | 168745351 |
| Molecular Formula | C37H46IrNO2- |
| Molecular Weight | 729.00 g/mol |
| Exact Mass | 729.32 |
| IUPAC Name | 2-(11,11-dimethyl-8H-benzo[a]fluoren-8-id-9-yl)pyridine;iridium;3,3,7,7-tetramethylnonane-4,6-diol |
| SMILES | CC1(C)c2cc(-c3ccccn3)[c-]cc2-c2ccc3ccccc3c21.CCC(C)(C)C(O)CC(O)C(C)(C)CC.[Ir] |
| InChI | InChI=1S/C24H18N.C13H28O2.Ir/c1-24(2)21-15-17(22-9-5-6-14-25-22)11-12-19(21)20-13-10-16-7-3-4-8-18(16)23(20)24;1-7-12(3,4)10(14)9-11(15)13(5,6)8-2;/h3-10,12-15H,1-2H3;10-11,14-15H,7-9H2,1-6H3;/q-1;; |
| InChIKey | DBXZAAKVICSKEY-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.00 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|