C40H42IrN2O2-2 — CID 170514397
iridium;2-phenyl-6-[(9R)-9-pyridin-2-yl-1H-fluoren-1-id-9-yl]pyridine;2,2,6,6-tetramethylheptane-3,5-diol (PubChem CID 170514397) has the molecular formula C40H42IrN2O2-2 and a molecular weight of 775.01 g/mol. Its IUPAC name is iridium;2-phenyl-6-[(9R)-9-pyridin-2-yl-1H-fluoren-1-id-9-yl]pyridine;2,2,6,6-tetramethylheptane-3,5-diol.
| Compound Name | iridium;2-phenyl-6-[(9R)-9-pyridin-2-yl-1H-fluoren-1-id-9-yl]pyridine;2,2,6,6-tetramethylheptane-3,5-diol |
|---|---|
| PubChem CID | 170514397 |
| Molecular Formula | C40H42IrN2O2-2 |
| Molecular Weight | 775.01 g/mol |
| Exact Mass | 775.29 |
| IUPAC Name | iridium;2-phenyl-6-[(9R)-9-pyridin-2-yl-1H-fluoren-1-id-9-yl]pyridine;2,2,6,6-tetramethylheptane-3,5-diol |
| SMILES | CC(C)(C)C(O)CC(O)C(C)(C)C.[Ir].[c-]1ccccc1-c1cccc([C@]2(c3ccccn3)c3[c-]cccc3-c3ccccc32)n1 |
| InChI | InChI=1S/C29H18N2.C11H24O2.Ir/c1-2-11-21(12-3-1)26-17-10-19-28(31-26)29(27-18-8-9-20-30-27)24-15-6-4-13-22(24)23-14-5-7-16-25(23)29;1-10(2,3)8(12)7-9(13)11(4,5)6;/h1-11,13-15,17-20H;8-9,12-13H,7H2,1-6H3;/q-2;;/t29-;;/m0../s1 |
| InChIKey | PGMPRDOBTYGVFQ-UJXPALLWSA-N |
| XLogP | 8.30 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.01 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|