C20H19F3IrNO2- — CID 58841508
iridium;pentane-2,4-diol;1-(3,4,5-trifluorobenzene-6-id-1-yl)isoquinoline (PubChem CID 58841508) has the molecular formula C20H19F3IrNO2- and a molecular weight of 554.59 g/mol. Its IUPAC name is iridium;pentane-2,4-diol;1-(3,4,5-trifluorobenzene-6-id-1-yl)isoquinoline.
| Compound Name | iridium;pentane-2,4-diol;1-(3,4,5-trifluorobenzene-6-id-1-yl)isoquinoline |
|---|---|
| PubChem CID | 58841508 |
| Molecular Formula | C20H19F3IrNO2- |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 555.10 |
| IUPAC Name | iridium;pentane-2,4-diol;1-(3,4,5-trifluorobenzene-6-id-1-yl)isoquinoline |
| SMILES | CC(O)CC(C)O.Fc1[c-]c(-c2nccc3ccccc23)cc(F)c1F.[Ir] |
| InChI | InChI=1S/C15H7F3N.C5H12O2.Ir/c16-12-7-10(8-13(17)14(12)18)15-11-4-2-1-3-9(11)5-6-19-15;1-4(6)3-5(2)7;/h1-7H;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | UDMJYLALDDISQD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|