C22H24F2IrNO2- — CID 58281763
1-(2,5-difluorobenzene-6-id-1-yl)-6,7-dimethylisoquinoline;iridium;pentane-2,4-diol (PubChem CID 58281763) has the molecular formula C22H24F2IrNO2- and a molecular weight of 564.65 g/mol. Its IUPAC name is 1-(2,5-difluorobenzene-6-id-1-yl)-6,7-dimethylisoquinoline;iridium;pentane-2,4-diol.
| Compound Name | 1-(2,5-difluorobenzene-6-id-1-yl)-6,7-dimethylisoquinoline;iridium;pentane-2,4-diol |
|---|---|
| PubChem CID | 58281763 |
| Molecular Formula | C22H24F2IrNO2- |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | 1-(2,5-difluorobenzene-6-id-1-yl)-6,7-dimethylisoquinoline;iridium;pentane-2,4-diol |
| SMILES | CC(O)CC(C)O.Cc1cc2ccnc(-c3[c-]c(F)ccc3F)c2cc1C.[Ir] |
| InChI | InChI=1S/C17H12F2N.C5H12O2.Ir/c1-10-7-12-5-6-20-17(14(12)8-11(10)2)15-9-13(18)3-4-16(15)19;1-4(6)3-5(2)7;/h3-8H,1-2H3;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | ODFMBCACEFMTJS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|