C34H41IrN2O2- — CID 58518566
3,5-diphenyl-2-phenylpyrazine;iridium;2,2,6,6-tetramethyloctane-3,5-diol (PubChem CID 58518566) has the molecular formula C34H41IrN2O2- and a molecular weight of 701.93 g/mol. Its IUPAC name is 3,5-diphenyl-2-phenylpyrazine;iridium;2,2,6,6-tetramethyloctane-3,5-diol.
| Compound Name | 3,5-diphenyl-2-phenylpyrazine;iridium;2,2,6,6-tetramethyloctane-3,5-diol |
|---|---|
| PubChem CID | 58518566 |
| Molecular Formula | C34H41IrN2O2- |
| Molecular Weight | 701.93 g/mol |
| Exact Mass | 702.28 |
| IUPAC Name | 3,5-diphenyl-2-phenylpyrazine;iridium;2,2,6,6-tetramethyloctane-3,5-diol |
| SMILES | CCC(C)(C)C(O)CC(O)C(C)(C)C.[Ir].[c-]1ccccc1-c1ncc(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H15N2.C12H26O2.Ir/c1-4-10-17(11-5-1)20-16-23-21(18-12-6-2-7-13-18)22(24-20)19-14-8-3-9-15-19;1-7-12(5,6)10(14)8-9(13)11(2,3)4;/h1-12,14-16H;9-10,13-14H,7-8H2,1-6H3;/q-1;; |
| InChIKey | VEAHNAMTDLKWDO-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.93 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|