C24H28F3IrN2O2- — CID 58219437
3,5-dimethyl-2-(2H-naphthalen-2-id-1-yl)pyrazine;iridium;1,1,1-trifluoro-5,5-dimethylhexane-2,4-diol (PubChem CID 58219437) has the molecular formula C24H28F3IrN2O2- and a molecular weight of 625.71 g/mol. Its IUPAC name is 3,5-dimethyl-2-(2H-naphthalen-2-id-1-yl)pyrazine;iridium;1,1,1-trifluoro-5,5-dimethylhexane-2,4-diol.
| Compound Name | 3,5-dimethyl-2-(2H-naphthalen-2-id-1-yl)pyrazine;iridium;1,1,1-trifluoro-5,5-dimethylhexane-2,4-diol |
|---|---|
| PubChem CID | 58219437 |
| Molecular Formula | C24H28F3IrN2O2- |
| Molecular Weight | 625.71 g/mol |
| Exact Mass | 626.17 |
| IUPAC Name | 3,5-dimethyl-2-(2H-naphthalen-2-id-1-yl)pyrazine;iridium;1,1,1-trifluoro-5,5-dimethylhexane-2,4-diol |
| SMILES | CC(C)(C)C(O)CC(O)C(F)(F)F.Cc1cnc(-c2[c-]ccc3ccccc23)c(C)n1.[Ir] |
| InChI | InChI=1S/C16H13N2.C8H15F3O2.Ir/c1-11-10-17-16(12(2)18-11)15-9-5-7-13-6-3-4-8-14(13)15;1-7(2,3)5(12)4-6(13)8(9,10)11;/h3-8,10H,1-2H3;5-6,12-13H,4H2,1-3H3;/q-1;; |
| InChIKey | BAOSPGAXDIHNMC-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.71 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|