C21H21F3IrNO2- — CID 58841514
iridium;pentane-2,4-diol;1-[3-(trifluoromethyl)benzene-6-id-1-yl]isoquinoline (PubChem CID 58841514) has the molecular formula C21H21F3IrNO2- and a molecular weight of 568.62 g/mol. Its IUPAC name is iridium;pentane-2,4-diol;1-[3-(trifluoromethyl)benzene-6-id-1-yl]isoquinoline.
| Compound Name | iridium;pentane-2,4-diol;1-[3-(trifluoromethyl)benzene-6-id-1-yl]isoquinoline |
|---|---|
| PubChem CID | 58841514 |
| Molecular Formula | C21H21F3IrNO2- |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 569.12 |
| IUPAC Name | iridium;pentane-2,4-diol;1-[3-(trifluoromethyl)benzene-6-id-1-yl]isoquinoline |
| SMILES | CC(O)CC(C)O.FC(F)(F)c1cc[c-]c(-c2nccc3ccccc23)c1.[Ir] |
| InChI | InChI=1S/C16H9F3N.C5H12O2.Ir/c17-16(18,19)13-6-3-5-12(10-13)15-14-7-2-1-4-11(14)8-9-20-15;1-4(6)3-5(2)7;/h1-4,6-10H;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | HUUQTRUNLUHHBW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|