C33H33Cl2N5O2S2 — CID 58714389
(3S)-N-[3-[2-[2-[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]amino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]phenyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 58714389) has the molecular formula C33H33Cl2N5O2S2 and a molecular weight of 666.70 g/mol. Its IUPAC name is (3S)-N-[3-[2-[2-[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]amino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]phenyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | (3S)-N-[3-[2-[2-[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]amino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]phenyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 58714389 |
| Molecular Formula | C33H33Cl2N5O2S2 |
| Molecular Weight | 666.70 g/mol |
| Exact Mass | 665.15 |
| IUPAC Name | (3S)-N-[3-[2-[2-[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]amino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]phenyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | O=C(CSc1nc(-c2cccc(NC(=O)[C@@H]3Cc4ccccc4CN3)c2)cs1)NC1CCN(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C33H33Cl2N5O2S2/c34-27-9-8-21(14-28(27)35)18-40-12-10-25(11-13-40)37-31(41)20-44-33-39-30(19-43-33)23-6-3-7-26(15-23)38-32(42)29-16-22-4-1-2-5-24(22)17-36-29/h1-9,14-15,19,25,29,36H,10-13,16-18,20H2,(H,37,41)(H,38,42)/t29-/m0/s1 |
| InChIKey | OMOYMYHQEZEALA-LJAQVGFWSA-N |
| XLogP | 6.64 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.70 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |