C10H22OP4 — CID 58714725
diphosphanyl-[(7R,8S)-8-methyl-1-oxaspiro[4.5]decan-7-yl]-phosphanylphosphane (PubChem CID 58714725) has the molecular formula C10H22OP4 and a molecular weight of 282.18 g/mol. Its IUPAC name is diphosphanyl-[(7R,8S)-8-methyl-1-oxaspiro[4.5]decan-7-yl]-phosphanylphosphane.
| Compound Name | diphosphanyl-[(7R,8S)-8-methyl-1-oxaspiro[4.5]decan-7-yl]-phosphanylphosphane |
|---|---|
| PubChem CID | 58714725 |
| Molecular Formula | C10H22OP4 |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | diphosphanyl-[(7R,8S)-8-methyl-1-oxaspiro[4.5]decan-7-yl]-phosphanylphosphane |
| SMILES | C[C@H]1CCC2(CCCO2)C[C@H]1P(P)PP |
| InChI | InChI=1S/C10H22OP4/c1-8-3-5-10(4-2-6-11-10)7-9(8)15(13)14-12/h8-9,14H,2-7,12-13H2,1H3/t8-,9+,10?,15?/m0/s1 |
| InChIKey | MCHABJUEFXKKQC-MSHQNWJPSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|