About 1-[2,3-bis(methylamino)propanoyl]pyrrolidine-2-carbonitrile
1-[2,3-bis(methylamino)propanoyl]pyrrolidine-2-carbonitrile (PubChem CID 58719540) has the molecular formula C10H18N4O
and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-[2,3-bis(methylamino)propanoyl]pyrrolidine-2-carbonitrile.
Molecular Properties
| Compound Name | 1-[2,3-bis(methylamino)propanoyl]pyrrolidine-2-carbonitrile |
| PubChem CID | 58719540 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 1-[2,3-bis(methylamino)propanoyl]pyrrolidine-2-carbonitrile |
| SMILES | CNCC(NC)C(=O)N1CCCC1C#N |
| InChI | InChI=1S/C10H18N4O/c1-12-7-9(13-2)10(15)14-5-3-4-8(14)6-11/h8-9,12-13H,3-5,7H2,1-2H3 |
| InChIKey | WSTSSEKYVBAKCY-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2,3-bis(methylamino)propanoyl]pyrrolidine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,3-bis(methylamino)propanoyl]pyrrolidine-2-carbonitrile?
The IUPAC name of 1-[2,3-bis(methylamino)propanoyl]pyrrolidine-2-carbonitrile (CID 58719540) is 1-[2,3-bis(methylamino)propanoyl]pyrrolidine-2-carbonitrile.
What is the SMILES notation for 1-[2,3-bis(methylamino)propanoyl]pyrrolidine-2-carbonitrile?
The canonical SMILES for 1-[2,3-bis(methylamino)propanoyl]pyrrolidine-2-carbonitrile is CNCC(NC)C(=O)N1CCCC1C#N.
What is the InChIKey of 1-[2,3-bis(methylamino)propanoyl]pyrrolidine-2-carbonitrile?
The InChIKey is WSTSSEKYVBAKCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O/c1-12-7-9(13-2)10(15)14-5-3-4-8(14)6-11/h8-9,12-13H,3-5,7H2,1-2H3.
What are the key properties of 1-[2,3-bis(methylamino)propanoyl]pyrrolidine-2-carbonitrile?
1-[2,3-bis(methylamino)propanoyl]pyrrolidine-2-carbonitrile has a molecular weight of 210.28 g/mol, XLogP of -0.69, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,3-bis(methylamino)propanoyl]pyrrolidine-2-carbonitrile is sourced from PubChem (CID 58719540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).