C17H30N4O — CID 67189818
2-cyano-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide (PubChem CID 67189818) has the molecular formula C17H30N4O and a molecular weight of 306.45 g/mol. Its IUPAC name is 2-cyano-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide.
| Compound Name | 2-cyano-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 67189818 |
| Molecular Formula | C17H30N4O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | 2-cyano-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
| SMILES | CNC[C@H](CC1CCCCC1)NC(=O)N1CCCCC1C#N |
| InChI | InChI=1S/C17H30N4O/c1-19-13-15(11-14-7-3-2-4-8-14)20-17(22)21-10-6-5-9-16(21)12-18/h14-16,19H,2-11,13H2,1H3,(H,20,22)/t15-,16?/m0/s1 |
| InChIKey | ROMDYOXBMKYMEH-VYRBHSGPSA-N |
| XLogP | 2.63 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |