About 4-[[4-[4-(furan-2-yl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile
4-[[4-[4-(furan-2-yl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 58719799) has the molecular formula C23H19N5O
and a molecular weight of 381.44 g/mol. Its IUPAC name is 4-[[4-[4-(furan-2-yl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile.
Molecular Properties
| Compound Name | 4-[[4-[4-(furan-2-yl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile |
| PubChem CID | 58719799 |
| Molecular Formula | C23H19N5O |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 4-[[4-[4-(furan-2-yl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(-c2ccco2)cc(C)c1Nc1ccnc(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C23H19N5O/c1-15-12-18(20-4-3-11-29-20)13-16(2)22(15)27-21-9-10-25-23(28-21)26-19-7-5-17(14-24)6-8-19/h3-13H,1-2H3,(H2,25,26,27,28) |
| InChIKey | GUEBVJORTBLOKW-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 86.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[4-[4-(furan-2-yl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-[4-(furan-2-yl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile?
The IUPAC name of 4-[[4-[4-(furan-2-yl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile (CID 58719799) is 4-[[4-[4-(furan-2-yl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile.
What is the SMILES notation for 4-[[4-[4-(furan-2-yl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile?
The canonical SMILES for 4-[[4-[4-(furan-2-yl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile is Cc1cc(-c2ccco2)cc(C)c1Nc1ccnc(Nc2ccc(C#N)cc2)n1.
What is the InChIKey of 4-[[4-[4-(furan-2-yl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile?
The InChIKey is GUEBVJORTBLOKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N5O/c1-15-12-18(20-4-3-11-29-20)13-16(2)22(15)27-21-9-10-25-23(28-21)26-19-7-5-17(14-24)6-8-19/h3-13H,1-2H3,(H2,25,26,27,28).
What are the key properties of 4-[[4-[4-(furan-2-yl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile?
4-[[4-[4-(furan-2-yl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile has a molecular weight of 381.44 g/mol, XLogP of 5.71, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-[4-(furan-2-yl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile is sourced from PubChem (CID 58719799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).