C45H54O4 — CID 58720445
3-[7-(5-formyl-2-methoxyphenyl)-9,9-dioctylfluoren-2-yl]-4-methoxybenzaldehyde (PubChem CID 58720445) has the molecular formula C45H54O4 and a molecular weight of 658.92 g/mol. Its IUPAC name is 3-[7-(5-formyl-2-methoxyphenyl)-9,9-dioctylfluoren-2-yl]-4-methoxybenzaldehyde.
| Compound Name | 3-[7-(5-formyl-2-methoxyphenyl)-9,9-dioctylfluoren-2-yl]-4-methoxybenzaldehyde |
|---|---|
| PubChem CID | 58720445 |
| Molecular Formula | C45H54O4 |
| Molecular Weight | 658.92 g/mol |
| Exact Mass | 658.40 |
| IUPAC Name | 3-[7-(5-formyl-2-methoxyphenyl)-9,9-dioctylfluoren-2-yl]-4-methoxybenzaldehyde |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(-c3cc(C=O)ccc3OC)ccc2-c2ccc(-c3cc(C=O)ccc3OC)cc21 |
| InChI | InChI=1S/C45H54O4/c1-5-7-9-11-13-15-25-45(26-16-14-12-10-8-6-2)41-29-35(39-27-33(31-46)17-23-43(39)48-3)19-21-37(41)38-22-20-36(30-42(38)45)40-28-34(32-47)18-24-44(40)49-4/h17-24,27-32H,5-16,25-26H2,1-4H3 |
| InChIKey | CWMCNRMWIPODPV-UHFFFAOYSA-N |
| XLogP | 12.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.92 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|